![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Chemical Admixtures ..> | 2008-10-21 11:28 | 4.3M | |
| Fast Track Concrete.ppt | 2007-11-19 11:32 | 778K | |
| Hydrology.ppt | 2007-11-26 12:43 | 123K | |
| Introduction and Ove..> | 2007-09-10 01:53 | 941K | |
| Pavement Basics.ppt | 2007-09-24 17:05 | 1.0M | |
| Pervious Concrete.ppt | 2007-11-12 02:08 | 1.0M | |
| ROLLER COMPACTED CON..> | 2007-10-22 15:41 | 142K | |
| SCC - NJIT,NJ.pdf | 2008-10-21 11:28 | 1.6M | |
| Smooth Pavements.ppt | 2007-09-30 22:00 | 1.8M | |
| Table and Charts for..> | 2008-09-02 10:56 | 2.6M | |
| Ultra-Thin Whitetopp..> | 2007-11-19 00:14 | 215K | |
| Underground Systems ..> | 2007-12-09 23:56 | 240K | |